C22H23O2P — CID 102282785
2-diphenylphosphanylethyl (1S)-2,4-dimethylcyclopenta-2,4-diene-1-carboxylate (PubChem CID 102282785) has the molecular formula C22H23O2P and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-diphenylphosphanylethyl (1S)-2,4-dimethylcyclopenta-2,4-diene-1-carboxylate.
| Compound Name | 2-diphenylphosphanylethyl (1S)-2,4-dimethylcyclopenta-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 102282785 |
| Molecular Formula | C22H23O2P |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-diphenylphosphanylethyl (1S)-2,4-dimethylcyclopenta-2,4-diene-1-carboxylate |
| SMILES | CC1=C[C@H](C(=O)OCCP(c2ccccc2)c2ccccc2)C(C)=C1 |
| InChI | InChI=1S/C22H23O2P/c1-17-15-18(2)21(16-17)22(23)24-13-14-25(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,15-16,21H,13-14H2,1-2H3/t21-/m0/s1 |
| InChIKey | QZSBTSUODNAVSM-NRFANRHFSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|