C13H11NO — CID 102284803
(E)-3-cyclopenta-2,4-dien-1-yl-1-pyridin-2-ylprop-2-en-1-one (PubChem CID 102284803) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is (E)-3-cyclopenta-2,4-dien-1-yl-1-pyridin-2-ylprop-2-en-1-one.
| Compound Name | (E)-3-cyclopenta-2,4-dien-1-yl-1-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 102284803 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (E)-3-cyclopenta-2,4-dien-1-yl-1-pyridin-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/C1C=CC=C1)c1ccccn1 |
| InChI | InChI=1S/C13H11NO/c15-13(12-7-3-4-10-14-12)9-8-11-5-1-2-6-11/h1-11H/b9-8+ |
| InChIKey | MRECSWGVKJCQRT-CMDGGOBGSA-N |
| XLogP | 2.56 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|