C24H26BNO2 — CID 102285726
4-diphenylboranyloxy-N-[(1R)-1-phenylethyl]butanamide (PubChem CID 102285726) has the molecular formula C24H26BNO2 and a molecular weight of 371.29 g/mol. Its IUPAC name is 4-diphenylboranyloxy-N-[(1R)-1-phenylethyl]butanamide.
| Compound Name | 4-diphenylboranyloxy-N-[(1R)-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 102285726 |
| Molecular Formula | C24H26BNO2 |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 4-diphenylboranyloxy-N-[(1R)-1-phenylethyl]butanamide |
| SMILES | C[C@@H](NC(=O)CCCOB(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26BNO2/c1-20(21-12-5-2-6-13-21)26-24(27)18-11-19-28-25(22-14-7-3-8-15-22)23-16-9-4-10-17-23/h2-10,12-17,20H,11,18-19H2,1H3,(H,26,27)/t20-/m1/s1 |
| InChIKey | SDAKRVIJPRNTKU-HXUWFJFHSA-N |
| XLogP | 3.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|