C15H18F3N3O3 — CID 102285838
methyl (2S)-2-amino-5-[2-methoxy-4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]pentanoate (PubChem CID 102285838) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is methyl (2S)-2-amino-5-[2-methoxy-4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]pentanoate.
| Compound Name | methyl (2S)-2-amino-5-[2-methoxy-4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]pentanoate |
|---|---|
| PubChem CID | 102285838 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | methyl (2S)-2-amino-5-[2-methoxy-4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]pentanoate |
| SMILES | COC(=O)[C@@H](N)CCCc1ccc(C2(C(F)(F)F)N=N2)cc1OC |
| InChI | InChI=1S/C15H18F3N3O3/c1-23-12-8-10(14(20-21-14)15(16,17)18)7-6-9(12)4-3-5-11(19)13(22)24-2/h6-8,11H,3-5,19H2,1-2H3/t11-/m0/s1 |
| InChIKey | RRHXOWUXCDJYDY-NSHDSACASA-N |
| XLogP | 2.70 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |