C9H11Cl2N3OS — CID 102286122
4-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)morpholine (PubChem CID 102286122) has the molecular formula C9H11Cl2N3OS and a molecular weight of 280.18 g/mol. Its IUPAC name is 4-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)morpholine.
| Compound Name | 4-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)morpholine |
|---|---|
| PubChem CID | 102286122 |
| Molecular Formula | C9H11Cl2N3OS |
| Molecular Weight | 280.18 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 4-(4,6-dichloro-2-methylsulfanylpyrimidin-5-yl)morpholine |
| SMILES | CSc1nc(Cl)c(N2CCOCC2)c(Cl)n1 |
| InChI | InChI=1S/C9H11Cl2N3OS/c1-16-9-12-7(10)6(8(11)13-9)14-2-4-15-5-3-14/h2-5H2,1H3 |
| InChIKey | CTPKUGWNWTWWAH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |