About [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol
[5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol (PubChem CID 102290574) has the molecular formula C20H22O2S2
and a molecular weight of 358.53 g/mol. Its IUPAC name is [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol |
| PubChem CID | 102290574 |
| Molecular Formula | C20H22O2S2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol |
| SMILES | Cc1ccc(Cc2cc(Cc3ccc(C)s3)c(CO)cc2CO)s1 |
| InChI | InChI=1S/C20H22O2S2/c1-13-3-5-19(23-13)9-15-7-16(10-20-6-4-14(2)24-20)18(12-22)8-17(15)11-21/h3-8,21-22H,9-12H2,1-2H3 |
| InChIKey | WIMSDPCGFAUWLI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol?
The IUPAC name of [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol (CID 102290574) is [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol is Cc1ccc(Cc2cc(Cc3ccc(C)s3)c(CO)cc2CO)s1.
What is the InChIKey of [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol?
The InChIKey is WIMSDPCGFAUWLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O2S2/c1-13-3-5-19(23-13)9-15-7-16(10-20-6-4-14(2)24-20)18(12-22)8-17(15)11-21/h3-8,21-22H,9-12H2,1-2H3.
What are the key properties of [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol?
[5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol has a molecular weight of 358.53 g/mol, XLogP of 4.59, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-2,4-bis[(5-methylthiophen-2-yl)methyl]phenyl]methanol is sourced from PubChem (CID 102290574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).