C8H12OS — CID 13111508
1-(5-methylthiophen-2-yl)propan-2-ol (PubChem CID 13111508) has the molecular formula C8H12OS and a molecular weight of 156.25 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)propan-2-ol.
| Compound Name | 1-(5-methylthiophen-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 13111508 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)propan-2-ol |
| SMILES | Cc1ccc(CC(C)O)s1 |
| InChI | InChI=1S/C8H12OS/c1-6(9)5-8-4-3-7(2)10-8/h3-4,6,9H,5H2,1-2H3 |
| InChIKey | IHDYOFRFLFTDMP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |