C11H13NOS2 — CID 115091227
1-[2-(5-methylthiophen-2-yl)-1,3-thiazol-5-yl]propan-2-ol (PubChem CID 115091227) has the molecular formula C11H13NOS2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-[2-(5-methylthiophen-2-yl)-1,3-thiazol-5-yl]propan-2-ol.
| Compound Name | 1-[2-(5-methylthiophen-2-yl)-1,3-thiazol-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 115091227 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 1-[2-(5-methylthiophen-2-yl)-1,3-thiazol-5-yl]propan-2-ol |
| SMILES | Cc1ccc(-c2ncc(CC(C)O)s2)s1 |
| InChI | InChI=1S/C11H13NOS2/c1-7(13)5-9-6-12-11(15-9)10-4-3-8(2)14-10/h3-4,6-7,13H,5H2,1-2H3 |
| InChIKey | QHLSECIXRJZYAR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |