C15H20FNO3 — CID 102292638
(3S)-N,N-diethyl-5-(2-fluorophenyl)-3-hydroxy-5-oxopentanamide (PubChem CID 102292638) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is (3S)-N,N-diethyl-5-(2-fluorophenyl)-3-hydroxy-5-oxopentanamide.
| Compound Name | (3S)-N,N-diethyl-5-(2-fluorophenyl)-3-hydroxy-5-oxopentanamide |
|---|---|
| PubChem CID | 102292638 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3S)-N,N-diethyl-5-(2-fluorophenyl)-3-hydroxy-5-oxopentanamide |
| SMILES | CCN(CC)C(=O)C[C@@H](O)CC(=O)c1ccccc1F |
| InChI | InChI=1S/C15H20FNO3/c1-3-17(4-2)15(20)10-11(18)9-14(19)12-7-5-6-8-13(12)16/h5-8,11,18H,3-4,9-10H2,1-2H3/t11-/m0/s1 |
| InChIKey | LLWTYJRCGGOPMK-NSHDSACASA-N |
| XLogP | 2.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |