C30H33F6N3O3 — CID 102292739
1,3,5-tris[2,2-difluoro-2-(3-methoxyphenyl)ethyl]-1,3,5-triazinane (PubChem CID 102292739) has the molecular formula C30H33F6N3O3 and a molecular weight of 597.60 g/mol. Its IUPAC name is 1,3,5-tris[2,2-difluoro-2-(3-methoxyphenyl)ethyl]-1,3,5-triazinane.
| Compound Name | 1,3,5-tris[2,2-difluoro-2-(3-methoxyphenyl)ethyl]-1,3,5-triazinane |
|---|---|
| PubChem CID | 102292739 |
| Molecular Formula | C30H33F6N3O3 |
| Molecular Weight | 597.60 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | 1,3,5-tris[2,2-difluoro-2-(3-methoxyphenyl)ethyl]-1,3,5-triazinane |
| SMILES | COc1cccc(C(F)(F)CN2CN(CC(F)(F)c3cccc(OC)c3)CN(CC(F)(F)c3cccc(OC)c3)C2)c1 |
| InChI | InChI=1S/C30H33F6N3O3/c1-40-25-10-4-7-22(13-25)28(31,32)16-37-19-38(17-29(33,34)23-8-5-11-26(14-23)41-2)21-39(20-37)18-30(35,36)24-9-6-12-27(15-24)42-3/h4-15H,16-21H2,1-3H3 |
| InChIKey | JQMRCGWCFVNDAX-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |