C33H63N3O3 — CID 102292990
1-N,3-N,5-N-tri(octan-2-yl)cyclohexane-1,3,5-tricarboxamide (PubChem CID 102292990) has the molecular formula C33H63N3O3 and a molecular weight of 549.89 g/mol. Its IUPAC name is 1-N,3-N,5-N-tri(octan-2-yl)cyclohexane-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tri(octan-2-yl)cyclohexane-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 102292990 |
| Molecular Formula | C33H63N3O3 |
| Molecular Weight | 549.89 g/mol |
| Exact Mass | 549.49 |
| IUPAC Name | 1-N,3-N,5-N-tri(octan-2-yl)cyclohexane-1,3,5-tricarboxamide |
| SMILES | CCCCCCC(C)NC(=O)C1CC(C(=O)NC(C)CCCCCC)CC(C(=O)NC(C)CCCCCC)C1 |
| InChI | InChI=1S/C33H63N3O3/c1-7-10-13-16-19-25(4)34-31(37)28-22-29(32(38)35-26(5)20-17-14-11-8-2)24-30(23-28)33(39)36-27(6)21-18-15-12-9-3/h25-30H,7-24H2,1-6H3,(H,34,37)(H,35,38)(H,36,39) |
| InChIKey | FRUPQGHTSJIZNC-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.89 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|