C19H36N2O2 — CID 27243583
1-(2,2-dimethylpropanoyl)-N-[(2R)-octan-2-yl]piperidine-4-carboxamide (PubChem CID 27243583) has the molecular formula C19H36N2O2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-[(2R)-octan-2-yl]piperidine-4-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-[(2R)-octan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 27243583 |
| Molecular Formula | C19H36N2O2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-[(2R)-octan-2-yl]piperidine-4-carboxamide |
| SMILES | CCCCCC[C@@H](C)NC(=O)C1CCN(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C19H36N2O2/c1-6-7-8-9-10-15(2)20-17(22)16-11-13-21(14-12-16)18(23)19(3,4)5/h15-16H,6-14H2,1-5H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | VNXNLSNTLQXTLJ-OAHLLOKOSA-N |
| XLogP | 3.75 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|