C25H26O6 — CID 102293136
diethyl 3-(2-methoxyphenyl)-4,9b-dihydro-1H-cyclopenta[c]chromene-2,2-dicarboxylate (PubChem CID 102293136) has the molecular formula C25H26O6 and a molecular weight of 422.48 g/mol. Its IUPAC name is diethyl 3-(2-methoxyphenyl)-4,9b-dihydro-1H-cyclopenta[c]chromene-2,2-dicarboxylate.
| Compound Name | diethyl 3-(2-methoxyphenyl)-4,9b-dihydro-1H-cyclopenta[c]chromene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102293136 |
| Molecular Formula | C25H26O6 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | diethyl 3-(2-methoxyphenyl)-4,9b-dihydro-1H-cyclopenta[c]chromene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2C(=C1c1ccccc1OC)COc1ccccc12 |
| InChI | InChI=1S/C25H26O6/c1-4-29-23(26)25(24(27)30-5-2)14-18-16-10-6-9-13-21(16)31-15-19(18)22(25)17-11-7-8-12-20(17)28-3/h6-13,18H,4-5,14-15H2,1-3H3 |
| InChIKey | ODZIJQGWNASMCQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|