C26H28O8 — CID 24814295
diethyl 2-(ethoxycarbonyloxymethyl)-3-(2-methoxyphenyl)indene-1,1-dicarboxylate (PubChem CID 24814295) has the molecular formula C26H28O8 and a molecular weight of 468.50 g/mol. Its IUPAC name is diethyl 2-(ethoxycarbonyloxymethyl)-3-(2-methoxyphenyl)indene-1,1-dicarboxylate.
| Compound Name | diethyl 2-(ethoxycarbonyloxymethyl)-3-(2-methoxyphenyl)indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 24814295 |
| Molecular Formula | C26H28O8 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | diethyl 2-(ethoxycarbonyloxymethyl)-3-(2-methoxyphenyl)indene-1,1-dicarboxylate |
| SMILES | CCOC(=O)OCC1=C(c2ccccc2OC)c2ccccc2C1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C26H28O8/c1-5-31-23(27)26(24(28)32-6-2)19-14-10-8-12-17(19)22(18-13-9-11-15-21(18)30-4)20(26)16-34-25(29)33-7-3/h8-15H,5-7,16H2,1-4H3 |
| InChIKey | SCRKEDUADIJNJC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|