C32H26N4O3S — CID 102293331
methyl 1-(3-methoxypropyl)-2-(6-thiophen-2-ylindolo[1,2-a]quinoxalin-1-yl)benzimidazole-5-carboxylate (PubChem CID 102293331) has the molecular formula C32H26N4O3S and a molecular weight of 546.65 g/mol. Its IUPAC name is methyl 1-(3-methoxypropyl)-2-(6-thiophen-2-ylindolo[1,2-a]quinoxalin-1-yl)benzimidazole-5-carboxylate.
| Compound Name | methyl 1-(3-methoxypropyl)-2-(6-thiophen-2-ylindolo[1,2-a]quinoxalin-1-yl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 102293331 |
| Molecular Formula | C32H26N4O3S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | methyl 1-(3-methoxypropyl)-2-(6-thiophen-2-ylindolo[1,2-a]quinoxalin-1-yl)benzimidazole-5-carboxylate |
| SMILES | COCCCn1c(-c2cccc3nc(-c4cccs4)c4cc5ccccc5n4c23)nc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C32H26N4O3S/c1-38-16-7-15-35-26-14-13-21(32(37)39-2)18-24(26)34-31(35)22-9-5-10-23-30(22)36-25-11-4-3-8-20(25)19-27(36)29(33-23)28-12-6-17-40-28/h3-6,8-14,17-19H,7,15-16H2,1-2H3 |
| InChIKey | CRCISKTUHOJGNE-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|