C20H12N4O4 — CID 102294044
12-(4-methoxybenzoyl)-8-oxa-14,15,16,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13,15-heptaen-9-one (PubChem CID 102294044) has the molecular formula C20H12N4O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is 12-(4-methoxybenzoyl)-8-oxa-14,15,16,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13,15-heptaen-9-one.
| Compound Name | 12-(4-methoxybenzoyl)-8-oxa-14,15,16,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13,15-heptaen-9-one |
|---|---|
| PubChem CID | 102294044 |
| Molecular Formula | C20H12N4O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 12-(4-methoxybenzoyl)-8-oxa-14,15,16,17-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(10),2,4,6,11,13,15-heptaen-9-one |
| SMILES | COc1ccc(C(=O)c2cc3c(=O)oc4ccccc4c3n3nnnc23)cc1 |
| InChI | InChI=1S/C20H12N4O4/c1-27-12-8-6-11(7-9-12)18(25)15-10-14-17(24-19(15)21-22-23-24)13-4-2-3-5-16(13)28-20(14)26/h2-10H,1H3 |
| InChIKey | JIGCZLJUPRGSRE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 99.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|