C14H21NS — CID 102294346
N,N-diethyl-1-thiophen-3-ylhex-1-yn-3-amine (PubChem CID 102294346) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is N,N-diethyl-1-thiophen-3-ylhex-1-yn-3-amine.
| Compound Name | N,N-diethyl-1-thiophen-3-ylhex-1-yn-3-amine |
|---|---|
| PubChem CID | 102294346 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N,N-diethyl-1-thiophen-3-ylhex-1-yn-3-amine |
| SMILES | CCCC(C#Cc1ccsc1)N(CC)CC |
| InChI | InChI=1S/C14H21NS/c1-4-7-14(15(5-2)6-3)9-8-13-10-11-16-12-13/h10-12,14H,4-7H2,1-3H3 |
| InChIKey | NLGKOEVIUDNSGC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|