C20H25BrN2O2 — CID 102294583
(R)-(2-bromo-6-methoxyquinolin-4-yl)-[(2S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol (PubChem CID 102294583) has the molecular formula C20H25BrN2O2 and a molecular weight of 405.34 g/mol. Its IUPAC name is (R)-(2-bromo-6-methoxyquinolin-4-yl)-[(2S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol.
| Compound Name | (R)-(2-bromo-6-methoxyquinolin-4-yl)-[(2S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
|---|---|
| PubChem CID | 102294583 |
| Molecular Formula | C20H25BrN2O2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (R)-(2-bromo-6-methoxyquinolin-4-yl)-[(2S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]methanol |
| SMILES | CC[C@H]1CN2CCC1C[C@H]2[C@H](O)c1cc(Br)nc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H25BrN2O2/c1-3-12-11-23-7-6-13(12)8-18(23)20(24)16-10-19(21)22-17-5-4-14(25-2)9-15(16)17/h4-5,9-10,12-13,18,20,24H,3,6-8,11H2,1-2H3/t12-,13?,18-,20+/m0/s1 |
| InChIKey | CKCNGBLINQBKAM-KWXGIDSPSA-N |
| XLogP | 4.16 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|