C30H48N2O3 — CID 70190276
(S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;1-pentoxypentane (PubChem CID 70190276) has the molecular formula C30H48N2O3 and a molecular weight of 484.73 g/mol. Its IUPAC name is (S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;1-pentoxypentane.
| Compound Name | (S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;1-pentoxypentane |
|---|---|
| PubChem CID | 70190276 |
| Molecular Formula | C30H48N2O3 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.37 |
| IUPAC Name | (S)-[(2R,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol;1-pentoxypentane |
| SMILES | CCCCCOCCCCC.CC[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](O)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C20H26N2O2.C10H22O/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;1-3-5-7-9-11-10-8-6-4-2/h4-6,8,11,13-14,19-20,23H,3,7,9-10,12H2,1-2H3;3-10H2,1-2H3/t13-,14-,19+,20-;/m0./s1 |
| InChIKey | DFWZUYLVQVMJEU-VJAUXQICSA-N |
| XLogP | 6.78 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|