C25H36N2O2 — CID 18598753
4-[(R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-pentoxymethyl]-6-methoxyquinoline (PubChem CID 18598753) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is 4-[(R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-pentoxymethyl]-6-methoxyquinoline.
| Compound Name | 4-[(R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-pentoxymethyl]-6-methoxyquinoline |
|---|---|
| PubChem CID | 18598753 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | 4-[(R)-[(2S,4S,5R)-5-ethyl-1-azabicyclo[2.2.2]octan-2-yl]-pentoxymethyl]-6-methoxyquinoline |
| SMILES | CCCCCO[C@H](c1ccnc2ccc(OC)cc12)[C@@H]1C[C@@H]2CCN1C[C@@H]2CC |
| InChI | InChI=1S/C25H36N2O2/c1-4-6-7-14-29-25(24-15-19-11-13-27(24)17-18(19)5-2)21-10-12-26-23-9-8-20(28-3)16-22(21)23/h8-10,12,16,18-19,24-25H,4-7,11,13-15,17H2,1-3H3/t18-,19-,24-,25+/m0/s1 |
| InChIKey | UOPFZKNPMSWSNS-QXVOXHNYSA-N |
| XLogP | 5.61 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|