C22H19NO3 — CID 102294745
2-butyl-5-hydroxy-7-phenylbenzo[de]isoquinoline-1,6-dione (PubChem CID 102294745) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 2-butyl-5-hydroxy-7-phenylbenzo[de]isoquinoline-1,6-dione.
| Compound Name | 2-butyl-5-hydroxy-7-phenylbenzo[de]isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 102294745 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-butyl-5-hydroxy-7-phenylbenzo[de]isoquinoline-1,6-dione |
| SMILES | CCCCn1cc2c3c(c(-c4ccccc4)ccc3c1=O)C(=O)C(O)=C2 |
| InChI | InChI=1S/C22H19NO3/c1-2-3-11-23-13-15-12-18(24)21(25)20-16(14-7-5-4-6-8-14)9-10-17(19(15)20)22(23)26/h4-10,12-13,24H,2-3,11H2,1H3 |
| InChIKey | YPHBYPBCEXTGDG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |