C23H21NO3 — CID 11783331
2-butyl-5-methoxy-7-phenylbenzo[de]isoquinoline-1,6-dione (PubChem CID 11783331) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-butyl-5-methoxy-7-phenylbenzo[de]isoquinoline-1,6-dione.
| Compound Name | 2-butyl-5-methoxy-7-phenylbenzo[de]isoquinoline-1,6-dione |
|---|---|
| PubChem CID | 11783331 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-butyl-5-methoxy-7-phenylbenzo[de]isoquinoline-1,6-dione |
| SMILES | CCCCn1cc2c3c(c(-c4ccccc4)ccc3c1=O)C(=O)C(OC)=C2 |
| InChI | InChI=1S/C23H21NO3/c1-3-4-12-24-14-16-13-19(27-2)22(25)21-17(15-8-6-5-7-9-15)10-11-18(20(16)21)23(24)26/h5-11,13-14H,3-4,12H2,1-2H3 |
| InChIKey | HWVYVDAOGDYGBR-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |