C23H23NO4 — CID 57380655
N-[3-(3-methoxy-1,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl]benzamide (PubChem CID 57380655) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[3-(3-methoxy-1,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl]benzamide.
| Compound Name | N-[3-(3-methoxy-1,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl]benzamide |
|---|---|
| PubChem CID | 57380655 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[3-(3-methoxy-1,4-dioxonaphthalen-2-yl)-2,2-dimethylpropyl]benzamide |
| SMILES | COC1=C(CC(C)(C)CNC(=O)c2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23NO4/c1-23(2,14-24-22(27)15-9-5-4-6-10-15)13-18-19(25)16-11-7-8-12-17(16)20(26)21(18)28-3/h4-12H,13-14H2,1-3H3,(H,24,27) |
| InChIKey | YKCFBMKXEZJBJV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|