C28H35N9O — CID 10229481
2-[4-[[3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(4-methoxyphenyl)pyrazolo[1,5-a]pyridin-7-yl]amino]butyl]guanidine (PubChem CID 10229481) has the molecular formula C28H35N9O and a molecular weight of 513.65 g/mol. Its IUPAC name is 2-[4-[[3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(4-methoxyphenyl)pyrazolo[1,5-a]pyridin-7-yl]amino]butyl]guanidine.
| Compound Name | 2-[4-[[3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(4-methoxyphenyl)pyrazolo[1,5-a]pyridin-7-yl]amino]butyl]guanidine |
|---|---|
| PubChem CID | 10229481 |
| Molecular Formula | C28H35N9O |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | 2-[4-[[3-[2-(cyclopentylamino)pyrimidin-4-yl]-2-(4-methoxyphenyl)pyrazolo[1,5-a]pyridin-7-yl]amino]butyl]guanidine |
| SMILES | COc1ccc(-c2nn3c(NCCCCN=C(N)N)cccc3c2-c2ccnc(NC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C28H35N9O/c1-38-21-13-11-19(12-14-21)26-25(22-15-18-33-28(35-22)34-20-7-2-3-8-20)23-9-6-10-24(37(23)36-26)31-16-4-5-17-32-27(29)30/h6,9-15,18,20,31H,2-5,7-8,16-17H2,1H3,(H4,29,30,32)(H,33,34,35) |
| InChIKey | UENOPHWRHNSCII-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|