C30H34N4O4 — CID 10229516
3-[2-(2-amino-2-oxoethoxy)phenyl]-2-hexyl-1-oxo-N-(pyridin-3-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 10229516) has the molecular formula C30H34N4O4 and a molecular weight of 514.63 g/mol. Its IUPAC name is 3-[2-(2-amino-2-oxoethoxy)phenyl]-2-hexyl-1-oxo-N-(pyridin-3-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | 3-[2-(2-amino-2-oxoethoxy)phenyl]-2-hexyl-1-oxo-N-(pyridin-3-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 10229516 |
| Molecular Formula | C30H34N4O4 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 3-[2-(2-amino-2-oxoethoxy)phenyl]-2-hexyl-1-oxo-N-(pyridin-3-ylmethyl)-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CCCCCCN1C(=O)c2ccccc2C(C(=O)NCc2cccnc2)C1c1ccccc1OCC(N)=O |
| InChI | InChI=1S/C30H34N4O4/c1-2-3-4-9-17-34-28(24-14-7-8-15-25(24)38-20-26(31)35)27(22-12-5-6-13-23(22)30(34)37)29(36)33-19-21-11-10-16-32-18-21/h5-8,10-16,18,27-28H,2-4,9,17,19-20H2,1H3,(H2,31,35)(H,33,36) |
| InChIKey | WHEJKUFWGRRTAA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|