C23H20ClN3O2 — CID 15996201
2-[2-(4-chlorophenyl)ethyl]-3-oxo-N-(pyridin-3-ylmethyl)-1H-isoindole-1-carboxamide (PubChem CID 15996201) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)ethyl]-3-oxo-N-(pyridin-3-ylmethyl)-1H-isoindole-1-carboxamide.
| Compound Name | 2-[2-(4-chlorophenyl)ethyl]-3-oxo-N-(pyridin-3-ylmethyl)-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 15996201 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 2-[2-(4-chlorophenyl)ethyl]-3-oxo-N-(pyridin-3-ylmethyl)-1H-isoindole-1-carboxamide |
| SMILES | O=C(NCc1cccnc1)C1c2ccccc2C(=O)N1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClN3O2/c24-18-9-7-16(8-10-18)11-13-27-21(19-5-1-2-6-20(19)23(27)29)22(28)26-15-17-4-3-12-25-14-17/h1-10,12,14,21H,11,13,15H2,(H,26,28) |
| InChIKey | CWQXAUOHJMQZSQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |