C23H19ClN2O3 — CID 68772752
N-[(3-chlorophenyl)methyl]-2-[(4-hydroxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 68772752) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-2-[(4-hydroxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-2-[(4-hydroxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 68772752 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-2-[(4-hydroxyphenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)C1c2ccccc2C(=O)N1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C23H19ClN2O3/c24-17-5-3-4-16(12-17)13-25-22(28)21-19-6-1-2-7-20(19)23(29)26(21)14-15-8-10-18(27)11-9-15/h1-12,21,27H,13-14H2,(H,25,28) |
| InChIKey | OGIYBHNOSMFGRX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |