C24H21ClN2O3 — CID 68772320
2-[(4-chlorophenyl)methyl]-5-hydroxy-3-oxo-N-(2-phenylethyl)-1H-isoindole-1-carboxamide (PubChem CID 68772320) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-5-hydroxy-3-oxo-N-(2-phenylethyl)-1H-isoindole-1-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)methyl]-5-hydroxy-3-oxo-N-(2-phenylethyl)-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 68772320 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-5-hydroxy-3-oxo-N-(2-phenylethyl)-1H-isoindole-1-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1c2ccc(O)cc2C(=O)N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClN2O3/c25-18-8-6-17(7-9-18)15-27-22(20-11-10-19(28)14-21(20)24(27)30)23(29)26-13-12-16-4-2-1-3-5-16/h1-11,14,22,28H,12-13,15H2,(H,26,29) |
| InChIKey | ZTJJXRZHASFVHH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |