C24H18ClN3O2 — CID 68772206
2-[(3-chlorophenyl)methyl]-N-[(3-cyanophenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide (PubChem CID 68772206) has the molecular formula C24H18ClN3O2 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methyl]-N-[(3-cyanophenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide.
| Compound Name | 2-[(3-chlorophenyl)methyl]-N-[(3-cyanophenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 68772206 |
| Molecular Formula | C24H18ClN3O2 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[(3-chlorophenyl)methyl]-N-[(3-cyanophenyl)methyl]-3-oxo-1H-isoindole-1-carboxamide |
| SMILES | N#Cc1cccc(CNC(=O)C2c3ccccc3C(=O)N2Cc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H18ClN3O2/c25-19-8-4-7-18(12-19)15-28-22(20-9-1-2-10-21(20)24(28)30)23(29)27-14-17-6-3-5-16(11-17)13-26/h1-12,22H,14-15H2,(H,27,29) |
| InChIKey | WICUNQLRTZATKG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |