C48H28F12N4 — CID 102296625
(5Z,9Z,15Z,19Z)-5,10,15,20-tetraphenyl-2,3,12,13-tetrakis(trifluoromethyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 102296625) has the molecular formula C48H28F12N4 and a molecular weight of 888.76 g/mol. Its IUPAC name is (5Z,9Z,15Z,19Z)-5,10,15,20-tetraphenyl-2,3,12,13-tetrakis(trifluoromethyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | (5Z,9Z,15Z,19Z)-5,10,15,20-tetraphenyl-2,3,12,13-tetrakis(trifluoromethyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 102296625 |
| Molecular Formula | C48H28F12N4 |
| Molecular Weight | 888.76 g/mol |
| Exact Mass | 888.21 |
| IUPAC Name | (5Z,9Z,15Z,19Z)-5,10,15,20-tetraphenyl-2,3,12,13-tetrakis(trifluoromethyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | FC(F)(F)c1c2[nH]c(c1C(F)(F)F)/C(c1ccccc1)=c1/cc/c([nH]1)=C(\c1ccccc1)c1[nH]c(c(C(F)(F)F)c1C(F)(F)F)/C(c1ccccc1)=c1/cc/c([nH]1)=C/2c1ccccc1 |
| InChI | InChI=1S/C48H28F12N4/c49-45(50,51)37-38(46(52,53)54)42-35(27-17-9-3-10-18-27)31-23-24-32(62-31)36(28-19-11-4-12-20-28)44-40(48(58,59)60)39(47(55,56)57)43(64-44)34(26-15-7-2-8-16-26)30-22-21-29(61-30)33(41(37)63-42)25-13-5-1-6-14-25/h1-24,61-64H/b33-29-,34-30-,35-31-,36-32-,41-33-,42-35-,43-34-,44-36- |
| InChIKey | HVBIQJSXIGXUOT-QLCXEPOMSA-N |
| XLogP | 10.38 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.76 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |