C16H22O4 — CID 102297114
3-oxopropyl (3R)-3-(3-oxopropyl)-3-prop-1-en-2-ylcyclohexene-1-carboxylate (PubChem CID 102297114) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-oxopropyl (3R)-3-(3-oxopropyl)-3-prop-1-en-2-ylcyclohexene-1-carboxylate.
| Compound Name | 3-oxopropyl (3R)-3-(3-oxopropyl)-3-prop-1-en-2-ylcyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 102297114 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3-oxopropyl (3R)-3-(3-oxopropyl)-3-prop-1-en-2-ylcyclohexene-1-carboxylate |
| SMILES | C=C(C)[C@]1(CCC=O)C=C(C(=O)OCCC=O)CCC1 |
| InChI | InChI=1S/C16H22O4/c1-13(2)16(8-4-9-17)7-3-6-14(12-16)15(19)20-11-5-10-18/h9-10,12H,1,3-8,11H2,2H3/t16-/m1/s1 |
| InChIKey | NSTYXIJKCNRQDZ-MRXNPFEDSA-N |
| XLogP | 2.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|