C24H34O6 — CID 134147741
methyl 5-[4-(3-methoxycarbonyl-5,5-dimethyl-2-oxocyclohex-3-en-1-yl)butyl]-3,3-dimethyl-6-oxocyclohexene-1-carboxylate (PubChem CID 134147741) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is methyl 5-[4-(3-methoxycarbonyl-5,5-dimethyl-2-oxocyclohex-3-en-1-yl)butyl]-3,3-dimethyl-6-oxocyclohexene-1-carboxylate.
| Compound Name | methyl 5-[4-(3-methoxycarbonyl-5,5-dimethyl-2-oxocyclohex-3-en-1-yl)butyl]-3,3-dimethyl-6-oxocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 134147741 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | methyl 5-[4-(3-methoxycarbonyl-5,5-dimethyl-2-oxocyclohex-3-en-1-yl)butyl]-3,3-dimethyl-6-oxocyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CC(C)(C)CC(CCCCC2CC(C)(C)C=C(C(=O)OC)C2=O)C1=O |
| InChI | InChI=1S/C24H34O6/c1-23(2)11-15(19(25)17(13-23)21(27)29-5)9-7-8-10-16-12-24(3,4)14-18(20(16)26)22(28)30-6/h13-16H,7-12H2,1-6H3 |
| InChIKey | TUAONLHRCOKHTO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|