C13H20O3 — CID 134142606
tert-butyl 3,3-dimethyl-6-oxocyclohexene-1-carboxylate (PubChem CID 134142606) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is tert-butyl 3,3-dimethyl-6-oxocyclohexene-1-carboxylate.
| Compound Name | tert-butyl 3,3-dimethyl-6-oxocyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 134142606 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | tert-butyl 3,3-dimethyl-6-oxocyclohexene-1-carboxylate |
| SMILES | CC1(C)C=C(C(=O)OC(C)(C)C)C(=O)CC1 |
| InChI | InChI=1S/C13H20O3/c1-12(2,3)16-11(15)9-8-13(4,5)7-6-10(9)14/h8H,6-7H2,1-5H3 |
| InChIKey | YJGLBBCKCHWKKV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|