C20H38O2Si — CID 102297330
(E)-3-methyl-4-[(1S,2S,6R)-2-prop-1-en-2-yl-6-triethylsilyloxycyclohexyl]but-3-en-2-ol (PubChem CID 102297330) has the molecular formula C20H38O2Si and a molecular weight of 338.61 g/mol. Its IUPAC name is (E)-3-methyl-4-[(1S,2S,6R)-2-prop-1-en-2-yl-6-triethylsilyloxycyclohexyl]but-3-en-2-ol.
| Compound Name | (E)-3-methyl-4-[(1S,2S,6R)-2-prop-1-en-2-yl-6-triethylsilyloxycyclohexyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 102297330 |
| Molecular Formula | C20H38O2Si |
| Molecular Weight | 338.61 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (E)-3-methyl-4-[(1S,2S,6R)-2-prop-1-en-2-yl-6-triethylsilyloxycyclohexyl]but-3-en-2-ol |
| SMILES | C=C(C)[C@H]1CCC[C@@H](O[Si](CC)(CC)CC)[C@H]1/C=C(\C)C(C)O |
| InChI | InChI=1S/C20H38O2Si/c1-8-23(9-2,10-3)22-20-13-11-12-18(15(4)5)19(20)14-16(6)17(7)21/h14,17-21H,4,8-13H2,1-3,5-7H3/b16-14+/t17?,18-,19+,20-/m1/s1 |
| InChIKey | AMYIGHAKQWLABA-VZJJKFBGSA-N |
| XLogP | 5.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.61 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|