C39H35NS6 — CID 102298178
4,5,9,10-tetrakis(2,5-dimethylthiophen-3-yl)-7-(4-methylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 102298178) has the molecular formula C39H35NS6 and a molecular weight of 710.12 g/mol. Its IUPAC name is 4,5,9,10-tetrakis(2,5-dimethylthiophen-3-yl)-7-(4-methylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 4,5,9,10-tetrakis(2,5-dimethylthiophen-3-yl)-7-(4-methylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 102298178 |
| Molecular Formula | C39H35NS6 |
| Molecular Weight | 710.12 g/mol |
| Exact Mass | 709.11 |
| IUPAC Name | 4,5,9,10-tetrakis(2,5-dimethylthiophen-3-yl)-7-(4-methylphenyl)-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | Cc1ccc(-n2c3c(-c4cc(C)sc4C)c(-c4cc(C)sc4C)sc3c3sc(-c4cc(C)sc4C)c(-c4cc(C)sc4C)c32)cc1 |
| InChI | InChI=1S/C39H35NS6/c1-18-10-12-27(13-11-18)40-34-32(28-14-19(2)41-23(28)6)36(30-16-21(4)43-25(30)8)45-38(34)39-35(40)33(29-15-20(3)42-24(29)7)37(46-39)31-17-22(5)44-26(31)9/h10-17H,1-9H3 |
| InChIKey | IOFGRBFZEUGCBW-UHFFFAOYSA-N |
| XLogP | 14.60 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.12 |
| LogP ≤ 5 | 14.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |