C10H18Si — CID 102299021
2,2-dimethyl-1,3,4,5,6,7-hexahydro-2-benzosilole (PubChem CID 102299021) has the molecular formula C10H18Si and a molecular weight of 166.34 g/mol. Its IUPAC name is 2,2-dimethyl-1,3,4,5,6,7-hexahydro-2-benzosilole.
| Compound Name | 2,2-dimethyl-1,3,4,5,6,7-hexahydro-2-benzosilole |
|---|---|
| PubChem CID | 102299021 |
| Molecular Formula | C10H18Si |
| Molecular Weight | 166.34 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2,2-dimethyl-1,3,4,5,6,7-hexahydro-2-benzosilole |
| SMILES | C[Si]1(C)CC2=C(CCCC2)C1 |
| InChI | InChI=1S/C10H18Si/c1-11(2)7-9-5-3-4-6-10(9)8-11/h3-8H2,1-2H3 |
| InChIKey | IQDMSVLCFUGNPQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|