C8H16Si — CID 177095324
(3,4-dimethylcyclohex-3-en-1-yl)-tritritiosilane (PubChem CID 177095324) has the molecular formula C8H16Si and a molecular weight of 146.33 g/mol. Its IUPAC name is (3,4-dimethylcyclohex-3-en-1-yl)-tritritiosilane.
| Compound Name | (3,4-dimethylcyclohex-3-en-1-yl)-tritritiosilane |
|---|---|
| PubChem CID | 177095324 |
| Molecular Formula | C8H16Si |
| Molecular Weight | 146.33 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | (3,4-dimethylcyclohex-3-en-1-yl)-tritritiosilane |
| SMILES | [3H][Si]([3H])([3H])C1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C8H16Si/c1-6-3-4-8(9)5-7(6)2/h8H,3-5H2,1-2,9H3/i9T3 |
| InChIKey | PXALECBLKFXVBZ-GILWNQSFSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|