About 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one
3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one (PubChem CID 102300959) has the molecular formula C5H7NOS3
and a molecular weight of 193.32 g/mol. Its IUPAC name is 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one |
| PubChem CID | 102300959 |
| Molecular Formula | C5H7NOS3 |
| Molecular Weight | 193.32 g/mol |
| Exact Mass | 192.97 |
| IUPAC Name | 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one |
| SMILES | CCn1c(S)c(S)sc1=O |
| InChI | InChI=1S/C5H7NOS3/c1-2-6-3(8)4(9)10-5(6)7/h8-9H,2H2,1H3 |
| InChIKey | QSYMVOWXUVGSPP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 22.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one?
The IUPAC name of 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one (CID 102300959) is 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one.
What is the SMILES notation for 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one?
The canonical SMILES for 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one is CCn1c(S)c(S)sc1=O.
What is the InChIKey of 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one?
The InChIKey is QSYMVOWXUVGSPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NOS3/c1-2-6-3(8)4(9)10-5(6)7/h8-9H,2H2,1H3.
What are the key properties of 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one?
3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one has a molecular weight of 193.32 g/mol, XLogP of 1.51, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,5-bis(sulfanyl)-1,3-thiazol-2-one is sourced from PubChem (CID 102300959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).