About 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate
3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate (PubChem CID 139121533) has the molecular formula C5H5NOSSe2-2
and a molecular weight of 285.09 g/mol. Its IUPAC name is 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate.
Molecular Properties
| Compound Name | 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate |
| PubChem CID | 139121533 |
| Molecular Formula | C5H5NOSSe2-2 |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 286.84 |
| IUPAC Name | 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate |
| SMILES | CCn1c([Se-])c([Se-])sc1=O |
| InChI | InChI=1S/C5H7NOSSe2/c1-2-6-3(9)4(10)8-5(6)7/h9-10H,2H2,1H3/p-2 |
| InChIKey | JRBISKKBSCHJQU-UHFFFAOYSA-L |
| XLogP | -1.48 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate?
The IUPAC name of 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate (CID 139121533) is 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate.
What is the SMILES notation for 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate?
The canonical SMILES for 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate is CCn1c([Se-])c([Se-])sc1=O.
What is the InChIKey of 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate?
The InChIKey is JRBISKKBSCHJQU-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H7NOSSe2/c1-2-6-3(9)4(10)8-5(6)7/h9-10H,2H2,1H3/p-2.
What are the key properties of 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate?
3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate has a molecular weight of 285.09 g/mol, XLogP of -1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-oxo-1,3-thiazole-4,5-diselenolate is sourced from PubChem (CID 139121533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).