C28H20N4O8 — CID 102301018
2,7-diamino-4,9-bis(2-hydroxy-5-methoxyphenyl)-5,10-dioxo-4,9-dihydropyrano[2,3-g]chromene-3,8-dicarbonitrile (PubChem CID 102301018) has the molecular formula C28H20N4O8 and a molecular weight of 540.49 g/mol. Its IUPAC name is 2,7-diamino-4,9-bis(2-hydroxy-5-methoxyphenyl)-5,10-dioxo-4,9-dihydropyrano[2,3-g]chromene-3,8-dicarbonitrile.
| Compound Name | 2,7-diamino-4,9-bis(2-hydroxy-5-methoxyphenyl)-5,10-dioxo-4,9-dihydropyrano[2,3-g]chromene-3,8-dicarbonitrile |
|---|---|
| PubChem CID | 102301018 |
| Molecular Formula | C28H20N4O8 |
| Molecular Weight | 540.49 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 2,7-diamino-4,9-bis(2-hydroxy-5-methoxyphenyl)-5,10-dioxo-4,9-dihydropyrano[2,3-g]chromene-3,8-dicarbonitrile |
| SMILES | COc1ccc(O)c(C2C(C#N)=C(N)OC3=C2C(=O)C2=C(C3=O)C(c3cc(OC)ccc3O)C(C#N)=C(N)O2)c1 |
| InChI | InChI=1S/C28H20N4O8/c1-37-11-3-5-17(33)13(7-11)19-15(9-29)27(31)39-25-21(19)23(35)26-22(24(25)36)20(16(10-30)28(32)40-26)14-8-12(38-2)4-6-18(14)34/h3-8,19-20,33-34H,31-32H2,1-2H3 |
| InChIKey | SWMHHQDCFIBYEN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 211.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|