C27H24FN7O4 — CID 10230151
2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]-3-hydroxy-6-nitroquinazolin-4-one (PubChem CID 10230151) has the molecular formula C27H24FN7O4 and a molecular weight of 529.53 g/mol. Its IUPAC name is 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]-3-hydroxy-6-nitroquinazolin-4-one.
| Compound Name | 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]-3-hydroxy-6-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 10230151 |
| Molecular Formula | C27H24FN7O4 |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.19 |
| IUPAC Name | 2-[4-[[1-[(4-fluorophenyl)methyl]benzimidazol-2-yl]amino]piperidin-1-yl]-3-hydroxy-6-nitroquinazolin-4-one |
| SMILES | O=c1c2cc([N+](=O)[O-])ccc2nc(N2CCC(Nc3nc4ccccc4n3Cc3ccc(F)cc3)CC2)n1O |
| InChI | InChI=1S/C27H24FN7O4/c28-18-7-5-17(6-8-18)16-33-24-4-2-1-3-23(24)30-26(33)29-19-11-13-32(14-12-19)27-31-22-10-9-20(35(38)39)15-21(22)25(36)34(27)37/h1-10,15,19,37H,11-14,16H2,(H,29,30) |
| InChIKey | ASCGVQAENUBLAM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 131.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|