C32H39FN4O2 — CID 10230226
3-[N-(1-benzylpiperidin-4-yl)-4-[di(propan-2-yl)carbamoyl]anilino]-4-fluorobenzamide (PubChem CID 10230226) has the molecular formula C32H39FN4O2 and a molecular weight of 530.69 g/mol. Its IUPAC name is 3-[N-(1-benzylpiperidin-4-yl)-4-[di(propan-2-yl)carbamoyl]anilino]-4-fluorobenzamide.
| Compound Name | 3-[N-(1-benzylpiperidin-4-yl)-4-[di(propan-2-yl)carbamoyl]anilino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 10230226 |
| Molecular Formula | C32H39FN4O2 |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.31 |
| IUPAC Name | 3-[N-(1-benzylpiperidin-4-yl)-4-[di(propan-2-yl)carbamoyl]anilino]-4-fluorobenzamide |
| SMILES | CC(C)N(C(=O)c1ccc(N(c2cc(C(N)=O)ccc2F)C2CCN(Cc3ccccc3)CC2)cc1)C(C)C |
| InChI | InChI=1S/C32H39FN4O2/c1-22(2)36(23(3)4)32(39)25-10-13-27(14-11-25)37(30-20-26(31(34)38)12-15-29(30)33)28-16-18-35(19-17-28)21-24-8-6-5-7-9-24/h5-15,20,22-23,28H,16-19,21H2,1-4H3,(H2,34,38) |
| InChIKey | LOQTYMCWEIBKQK-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |