C30H33FN4O — CID 21031260
4-(N-(1-benzylpiperidin-4-yl)-5-cyano-2-fluoroanilino)-N,N-diethylbenzamide (PubChem CID 21031260) has the molecular formula C30H33FN4O and a molecular weight of 484.62 g/mol. Its IUPAC name is 4-(N-(1-benzylpiperidin-4-yl)-5-cyano-2-fluoroanilino)-N,N-diethylbenzamide.
| Compound Name | 4-(N-(1-benzylpiperidin-4-yl)-5-cyano-2-fluoroanilino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 21031260 |
| Molecular Formula | C30H33FN4O |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 4-(N-(1-benzylpiperidin-4-yl)-5-cyano-2-fluoroanilino)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(c2cc(C#N)ccc2F)C2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C30H33FN4O/c1-3-34(4-2)30(36)25-11-13-26(14-12-25)35(29-20-24(21-32)10-15-28(29)31)27-16-18-33(19-17-27)22-23-8-6-5-7-9-23/h5-15,20,27H,3-4,16-19,22H2,1-2H3 |
| InChIKey | VMKVGXCDDRKVHM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |