C30H34N4O — CID 21106887
2-(N-(1-benzylpiperidin-4-yl)-3-cyanoanilino)-N,N-diethylbenzamide (PubChem CID 21106887) has the molecular formula C30H34N4O and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-(N-(1-benzylpiperidin-4-yl)-3-cyanoanilino)-N,N-diethylbenzamide.
| Compound Name | 2-(N-(1-benzylpiperidin-4-yl)-3-cyanoanilino)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 21106887 |
| Molecular Formula | C30H34N4O |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 2-(N-(1-benzylpiperidin-4-yl)-3-cyanoanilino)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1ccccc1N(c1cccc(C#N)c1)C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C30H34N4O/c1-3-33(4-2)30(35)28-15-8-9-16-29(28)34(27-14-10-13-25(21-27)22-31)26-17-19-32(20-18-26)23-24-11-6-5-7-12-24/h5-16,21,26H,3-4,17-20,23H2,1-2H3 |
| InChIKey | ORFKQKLPTWHWFM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |