C24H29N3O3 — CID 24731106
N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-methoxy-N-(2-methoxyethyl)benzamide (PubChem CID 24731106) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-methoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-methoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 24731106 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-3-methoxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(C(=O)c1cccc(OC)c1)C1CCN(Cc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C24H29N3O3/c1-29-14-13-27(24(28)21-7-4-8-23(16-21)30-2)22-9-11-26(12-10-22)18-20-6-3-5-19(15-20)17-25/h3-8,15-16,22H,9-14,18H2,1-2H3 |
| InChIKey | QWSDFOGGUKSXQL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |