C17H27NO9 — CID 102302664
diethyl 2-[[[(2R)-2-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]amino]methylidene]propanedioate (PubChem CID 102302664) has the molecular formula C17H27NO9 and a molecular weight of 389.40 g/mol. Its IUPAC name is diethyl 2-[[[(2R)-2-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[[(2R)-2-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 102302664 |
| Molecular Formula | C17H27NO9 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | diethyl 2-[[[(2R)-2-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNC[C@@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O)C(=O)OCC |
| InChI | InChI=1S/C17H27NO9/c1-5-23-14(21)9(15(22)24-6-2)7-18-8-10(19)12-11(20)13-16(25-12)27-17(3,4)26-13/h7,10-13,16,18-20H,5-6,8H2,1-4H3/t10-,11+,12-,13-,16-/m1/s1 |
| InChIKey | HBOSJBMEMRHSES-ZUSNOYAUSA-N |
| XLogP | -0.82 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|