C21H27NO8 — CID 177478686
ethyl (Z)-2-[[(2R)-2-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate (PubChem CID 177478686) has the molecular formula C21H27NO8 and a molecular weight of 421.45 g/mol. Its IUPAC name is ethyl (Z)-2-[[(2R)-2-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate.
| Compound Name | ethyl (Z)-2-[[(2R)-2-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 177478686 |
| Molecular Formula | C21H27NO8 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | ethyl (Z)-2-[[(2R)-2-[(3aR,5R,6S,6aR)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-hydroxyethyl]iminomethyl]-3-hydroxy-3-phenylprop-2-enoate |
| SMILES | CCOC(=O)C(/C=N/C[C@@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1O)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C21H27NO8/c1-4-27-19(26)13(15(24)12-8-6-5-7-9-12)10-22-11-14(23)17-16(25)18-20(28-17)30-21(2,3)29-18/h5-10,14,16-18,20,23-25H,4,11H2,1-3H3/b15-13-,22-10+/t14-,16+,17-,18-,20-/m1/s1 |
| InChIKey | MQSIINAKNUXOPI-RRCUVATRSA-N |
| XLogP | 1.19 |
| TPSA | 127.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|