C28H25ClFN5O3 — CID 10230351
N-(5-chloro-2-pyridinyl)-5-ethynyl-2-[[2-fluoro-4-(piperidine-1-carboximidoyl)benzoyl]amino]-3-methoxybenzamide (PubChem CID 10230351) has the molecular formula C28H25ClFN5O3 and a molecular weight of 533.99 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-5-ethynyl-2-[[2-fluoro-4-(piperidine-1-carboximidoyl)benzoyl]amino]-3-methoxybenzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-5-ethynyl-2-[[2-fluoro-4-(piperidine-1-carboximidoyl)benzoyl]amino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 10230351 |
| Molecular Formula | C28H25ClFN5O3 |
| Molecular Weight | 533.99 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-5-ethynyl-2-[[2-fluoro-4-(piperidine-1-carboximidoyl)benzoyl]amino]-3-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2c(OC)cc(C#C)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N1CCCCC1 |
| InChI | InChI=1S/C28H25ClFN5O3/c1-3-17-13-21(28(37)33-24-10-8-19(29)16-32-24)25(23(14-17)38-2)34-27(36)20-9-7-18(15-22(20)30)26(31)35-11-5-4-6-12-35/h1,7-10,13-16,31H,4-6,11-12H2,2H3,(H,34,36)(H,32,33,37)/b31-26- |
| InChIKey | IGFPTHIEGMIXMM-ZXPTYKNPSA-N |
| XLogP | 5.18 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.99 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|