C23H21ClFN5O3 — CID 10298858
N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide (PubChem CID 10298858) has the molecular formula C23H21ClFN5O3 and a molecular weight of 469.90 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 10298858 |
| Molecular Formula | C23H21ClFN5O3 |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-methoxyphenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(OC)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C23H21ClFN5O3/c1-30(2)21(26)13-4-7-16(18(25)10-13)22(31)28-19-8-6-15(33-3)11-17(19)23(32)29-20-9-5-14(24)12-27-20/h4-12,26H,1-3H3,(H,28,31)(H,27,29,32)/b26-21- |
| InChIKey | LMFPOQCLAWEMKA-QLYXXIJNSA-N |
| XLogP | 4.27 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|