C46H47N3O7 — CID 102303901
1-[(4-methoxyphenyl)methyl]-4-[[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]amino]pyrimidin-2-one (PubChem CID 102303901) has the molecular formula C46H47N3O7 and a molecular weight of 753.90 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-4-[[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]amino]pyrimidin-2-one.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-4-[[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]amino]pyrimidin-2-one |
|---|---|
| PubChem CID | 102303901 |
| Molecular Formula | C46H47N3O7 |
| Molecular Weight | 753.90 g/mol |
| Exact Mass | 753.34 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-4-[[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]amino]pyrimidin-2-one |
| SMILES | COc1ccc(Cn2ccc(N[C@@H]3O[C@H](COCc4ccccc4)[C@@H](OCc4ccccc4)[C@H](OCc4ccccc4)[C@@H]3OCc3ccccc3)nc2=O)cc1 |
| InChI | InChI=1S/C46H47N3O7/c1-51-39-24-22-34(23-25-39)28-49-27-26-41(48-46(49)50)47-45-44(55-32-38-20-12-5-13-21-38)43(54-31-37-18-10-4-11-19-37)42(53-30-36-16-8-3-9-17-36)40(56-45)33-52-29-35-14-6-2-7-15-35/h2-27,40,42-45H,28-33H2,1H3,(H,47,48,50)/t40-,42-,43+,44+,45-/m1/s1 |
| InChIKey | FVNDIXJRNXYWFT-WABJNXAHSA-N |
| XLogP | 7.41 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.90 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |